CAS 608512-97-6
:6,8-Dihydro-8-(1H-imidazol-5-ylmethylene)-7H-pyrrolo[2,3-g]benzothiazol-7-one
Description:
6,8-Dihydro-8-(1H-imidazol-5-ylmethylene)-7H-pyrrolo[2,3-g]benzothiazol-7-one is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrolo and benzothiazole moiety. This compound features a dihydro-pyrrolo framework, indicating the presence of a saturated ring system, and an imidazole group that contributes to its potential biological activity. The presence of the imidazolylmethylene substituent suggests that it may engage in various interactions, such as hydrogen bonding or coordination with metal ions, which can enhance its reactivity and solubility in different solvents. The compound's structure may confer specific pharmacological properties, making it of interest in medicinal chemistry for potential therapeutic applications. Additionally, its molecular weight and specific functional groups can influence its stability, solubility, and interaction with biological targets. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity, warranting further investigation for its potential uses in drug development or other chemical applications.
Formula:C13H8N4OS
InChI:InChI=1S/C13H8N4OS/c18-13-8(3-7-4-14-5-15-7)11-9(17-13)1-2-10-12(11)19-6-16-10/h1-6H,(H,14,15)(H,17,18)
InChI key:InChIKey=VFBGXTUGODTSPK-UHFFFAOYSA-N
SMILES:C(=C1C=2C3=C(C=CC2NC1=O)N=CS3)C4=CN=CN4
Synonyms:- GW 506033X
- 7H-Pyrrolo[2,3-g]benzothiazol-7-one, 6,8-dihydro-8-(1H-imidazol-5-ylmethylene)-
- 7H-Pyrrolo[2,3-g]benzothiazol-7-one, 6,8-dihydro-8-(1H-imidazol-4-ylmethylene)-
- 6,8-Dihydro-8-(1H-imidazol-5-ylmethylene)-7H-pyrrolo[2,3-g]benzothiazol-7-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
8-(1H-IMIDAZOL-4-YLMETHYLENE)-6,8-DIHYDRO-THIAZOLO[5,4-E]INDOL-7-ONE
CAS:Formula:C13H8N4OSPurity:%Color and Shape:SolidMolecular weight:268.2938PKR-IN-C16
CAS:PKR-IN-C16: inhibits PKR autophosphorylation and translation blockade; binds ATP site; IC50 of 186-210 nM; protects cells from ER stress damage.Formula:C13H8N4OSPurity:97.8%Color and Shape:SolidMolecular weight:268.29Ref: TM-T16550
1mg40.00€2mg52.00€5mg84.00€1mL*10mM (DMSO)105.00€10mg130.00€25mg260.00€50mg409.00€100mg605.00€Imidazolo-oxindole PKR inhibitor C16(PKR Inhibitor)
CAS:Controlled ProductApplications PKR Inhibitor is a drug which acts as a selective inhibitor of the enzyme double-stranded RNA-dependent protein kinase (PKR). It has been shown to effectively inhibit PKR function in vivo and has neuroprotective and nootropic effects in animal studies.
References Jammi, N., et al.: Biochem. Biophys. Res. Commun., 308, 50 (2003); Ingrand, S., et al.: Neurosci. Lett., 409, 192 (2006); Chen, H., et al.: Eur. J. Neurosci., 28, 2003 (2008); Couturier, J., et al.: J. Biol. Chem., 285, 1272 (2010)Formula:C13H8N4OSColor and Shape:NeatMolecular weight:268.29



