CAS 608515-49-7

8-bromoisoquinolin-3(2H)-one

Description:

8-Bromoisoquinolin-3(2H)-one is a chemical compound characterized by its isoquinoline structure, which features a bromine atom at the 8-position and a ketone functional group at the 3-position. This compound is typically a solid at room temperature and exhibits a pale yellow to off-white appearance. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its bioactive properties. The presence of the bromine atom can influence its reactivity and solubility, making it a useful building block in organic synthesis. Additionally, the compound may exhibit fluorescence, which can be advantageous in various analytical applications. Its molecular structure allows for interactions with biological targets, making it of interest in research related to cancer, neurodegenerative diseases, and other therapeutic areas. As with many brominated compounds, it is essential to handle 8-bromoisoquinolin-3(2H)-one with care, considering potential toxicity and environmental impact.

Formula: C₉H₆BrNO

InChI: InChI=1/C9H6BrNO/c10-8-3-1-2-6-4-9(12)11-5-7(6)8/h1-5H,(H,11,12)

SMILES: c1cc2cc(ncc2c(c1)Br)O

Synonyms:

• 3(2H)-isoquinolinone, 8-bromo-
• 3-Isoquinolinol, 8-Bromo-
• 8-Bromoisoquinolin-3-ol

8-Bromo-isoquinolin-3-ol

CAS: 608515-49-7

Formula: C₉H₆BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 224.0540

Ref: IN-DA00EE8R

8-Bromo-3-hydroxyisoquinoline

CAS: 608515-49-7

8-Bromo-3-hydroxyisoquinoline

Formula: C₉H₆BrNO

Purity: ≥95%

Color and Shape: yellow solid

Molecular weight: 224.05g/mol

Ref: 54-OR42113

8-Bromo-2H-isoquinolin-3-one

CAS: 608515-49-7

Formula: C₉H₆BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 224.057

Ref: 10-F330170