CymitQuimica logo

CAS 608534-31-2

:

4-Methyl-^b-styrylboronic acid diethanolamine ester

Description:
4-Methyl-β-styrylboronic acid diethanolamine ester is a chemical compound characterized by its boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. The presence of the methyl group and the styryl moiety contributes to its hydrophobic characteristics, while the diethanolamine ester provides solubility in polar solvents and enhances its reactivity. This compound may exhibit properties such as moderate stability under ambient conditions, potential for polymerization, and the ability to participate in cross-coupling reactions, which are valuable in the synthesis of complex organic molecules. Additionally, due to the presence of the boron atom, it may also show unique optical properties and reactivity patterns. Its applications could extend to drug development, sensor technology, and materials science, particularly in the creation of boron-containing polymers or as a building block in organic synthesis. As with any chemical, proper handling and safety measures should be observed due to potential reactivity and toxicity.
Formula:C13H18BNO2
InChI:InChI=1/C13H18BNO2/c1-12-2-4-13(5-3-12)6-7-14-16-10-8-15-9-11-17-14/h2-7,15H,8-11H2,1H3/b7-6+
Synonyms:
  • 2-[(E)-2-(p-tolyl)vinyl]-1,3,6,2-dioxazaborocane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.