CAS 60857-16-1

Glycine, N-[(4-methoxyphenyl)methyl]-, ethyl ester

Description:

Glycine, N-[(4-methoxyphenyl)methyl]-, ethyl ester, with the CAS number 60857-16-1, is an organic compound that belongs to the class of amino acid derivatives. It features a glycine backbone, which is the simplest amino acid, and is modified with a 4-methoxyphenylmethyl group and an ethyl ester functional group. This compound typically exhibits characteristics such as being a white to off-white solid or a viscous liquid, depending on its purity and formulation. It is soluble in polar solvents like water and alcohols due to the presence of the amino and ester functional groups. Glycine derivatives are often studied for their potential biological activities, including roles in neurotransmission and as precursors in various biochemical pathways. The methoxyphenyl group may impart additional properties, such as increased lipophilicity, which can influence its interaction with biological systems. As with many organic compounds, safety and handling precautions should be observed, as the compound may have specific toxicity or reactivity profiles.

Formula: C₁₂H₁₇NO₃

InChI: InChI=1S/C12H17NO3/c1-3-16-12(14)9-13-8-10-4-6-11(15-2)7-5-10/h4-7,13H,3,8-9H2,1-2H3

InChI key: InChIKey=WQXUIGPEUIVGKQ-UHFFFAOYSA-N

SMILES: C(NCC(OCC)=O)C1=CC=C(OC)C=C1

Ethyl 2-((4-methoxybenzyl)amino)acetate

CAS: 60857-16-1

Ethyl 2-((4-methoxybenzyl)amino)acetate

Purity: 98%

Molecular weight: 223.27g/mol

Ref: 54-OR96360

Ethyl 2-{[(4-methoxyphenyl)methyl]amino}acetate

CAS: 60857-16-1

Formula: C₁₂H₁₇NO₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 223.272

Ref: 10-F078370