CAS 60886-80-8
:(1S)-(-)-Camphorsulfonylimine
Description:
(1S)-(-)-Camphorsulfonylimine is a chiral compound characterized by its unique structure, which includes a camphor-derived backbone and a sulfonylimine functional group. This compound is typically used in asymmetric synthesis and as a reagent in organic chemistry due to its ability to facilitate enantioselective reactions. It exhibits a specific optical rotation, indicating its chiral nature, and is often employed in the preparation of various pharmaceuticals and biologically active molecules. The presence of the sulfonyl group enhances its reactivity, making it a valuable intermediate in synthetic pathways. Additionally, (1S)-(-)-Camphorsulfonylimine is known for its stability under standard laboratory conditions, although it should be handled with care due to potential reactivity with nucleophiles. Its solubility properties can vary depending on the solvent used, and it is typically stored in a cool, dry place to maintain its integrity. Overall, this compound is significant in the field of synthetic organic chemistry, particularly in the development of chiral catalysts and ligands.
Formula:C10H15NO2S
InChI:InChI=1/C10H15NO2S/c1-9(2)7-3-4-10(9)6-14(12,13)11-8(10)5-7/h7H,3-6H2,1-2H3/t7-,10-/m1/s1
SMILES:CC1(C)[C@@H]2CC[C@@]31CS(=O)(=O)N=C3C2
Synonyms:- (7S)-10,10-dimethyl-5-thia-4-azatricyclo-(5.2.1.0
- Bornanesultam
- SCamphorsulfonylimine
- (3aS,6R)-8,8-dimethyl-4,5,6,7-tetrahydro-3a,6-methano-2,1-benzothiazole 2,2-dioxide
- (S)-(-)-10-Camphorsulfonylimine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(-)-10-Camphorsulfonimine
CAS:Formula:C10H15NO2SPurity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:213.30(1S)-(-)-Camphorsulfonylimine, 98+%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H15NO2SPurity:98+%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:213.30(3aS,6R)-8,8-Dimethyl-4,5,6,7-tetrahydro-3H-3a,6-methanobenzo[c]isothiazole 2,2-dioxide
CAS:Formula:C10H15NO2SPurity:97%Color and Shape:SolidMolecular weight:213.2966(1S)-(-)-Camphorsulfonylimine
CAS:(1S)-(-)-CamphorsulfonyliminePurity:98%Molecular weight:213.30g/mol(3aS,6R)-8,8-Dimethyl-4,5,6,7-tetrahydro-3H-3a,6-methanobenzo[c]isothiazole 2,2-dioxide
CAS:Formula:C10H15NO2SPurity:97%Color and Shape:SolidMolecular weight:213.3





