CAS 60889-05-6
:Quercetin 3-sulfate
Description:
Quercetin 3-sulfate is a flavonoid compound that is a sulfate derivative of quercetin, a naturally occurring polyphenolic compound found in various fruits, vegetables, and grains. It is characterized by its yellow crystalline appearance and is soluble in water, which enhances its bioavailability. Quercetin 3-sulfate exhibits antioxidant properties, helping to neutralize free radicals and reduce oxidative stress in biological systems. Additionally, it has been studied for its potential anti-inflammatory, antiviral, and anticancer activities, making it of interest in nutritional and pharmaceutical research. The compound is often investigated for its role in promoting cardiovascular health and supporting immune function. Its chemical structure includes a flavonoid backbone with a sulfate group attached at the 3-position, which influences its solubility and biological activity. As with many flavonoids, quercetin 3-sulfate may also interact with various cellular pathways, contributing to its health benefits. Overall, this compound represents a significant area of study in the context of dietary supplements and functional foods.
Formula:C15H10O10S
InChI:InChI=1S/C15H10O10S/c16-7-4-10(19)12-11(5-7)24-14(6-1-2-8(17)9(18)3-6)15(13(12)20)25-26(21,22)23/h1-5,16-19H,(H,21,22,23)
InChI key:InChIKey=DNAYVNOVGHZZLH-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)O)C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3
Synonyms:- Quercetin 3-sulfate
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(sulfooxy)-
- Quercetin 3-O-sulfate
- 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-(sulfooxy)-4H-1-benzopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
