CAS 60894-96-4
:2-Methyl-6-methylene-7-octen-4-ol
Description:
2-Methyl-6-methylene-7-octen-4-ol, with the CAS number 60894-96-4, is an organic compound characterized by its unique structure that includes a long carbon chain and multiple functional groups. This compound features a hydroxyl (-OH) group, which classifies it as an alcohol, and it contains both double bonds and a branched alkyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methylene and methyl groups enhances its hydrophobic characteristics, while the hydroxyl group provides some degree of polarity, allowing for hydrogen bonding. This compound may exhibit interesting properties such as volatility and solubility in organic solvents, making it useful in various chemical reactions and applications, including fragrance and flavor industries. Additionally, its structural features may influence its biological activity, potentially leading to applications in pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C10H18O
InChI:InChI=1S/C10H18O/c1-5-9(4)7-10(11)6-8(2)3/h5,8,10-11H,1,4,6-7H2,2-3H3
InChI key:InChIKey=RHAXCOKCIAVHPB-UHFFFAOYSA-N
SMILES:C(CC(C=C)=C)(CC(C)C)O
Synonyms:- (1)-2-Methyl-6-methyleneoct-7-en-4-ol
- 2-Methyl-6-methylene-7-octen-4-ol
- 2-Methyl-6-methylideneoct-7-en-4-ol
- 7-Octen-4-ol, 2-methyl-6-methylene-
- (±)-Ipsenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.