CymitQuimica logo

CAS 609-26-7

:

3-Ethyl-2-methylpentane

Description:
3-Ethyl-2-methylpentane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C8H18, indicating it consists of eight carbon atoms and eighteen hydrogen atoms. This compound features a pentane backbone with an ethyl group attached to the third carbon and a methyl group on the second carbon, contributing to its branched structure. 3-Ethyl-2-methylpentane is a colorless liquid at room temperature and is typically insoluble in water due to its nonpolar nature, but it is soluble in organic solvents. It has a relatively low boiling point compared to larger hydrocarbons, making it volatile. The compound is primarily used in research and as a reference standard in various chemical analyses. Its physical properties, such as boiling point and density, can vary slightly depending on the specific conditions and purity of the sample. As with many alkanes, it is flammable and should be handled with care in a controlled environment.
Formula:C8H18
InChI:InChI=1S/C8H18/c1-5-8(6-2)7(3)4/h7-8H,5-6H2,1-4H3
InChI key:InChIKey=DUPUVYJQZSLSJB-UHFFFAOYSA-N
SMILES:C(C(C)C)(CC)CC
Synonyms:
  • 2-Methyl-3-ethylpentane
  • 3-Ethyl-2-methylpentan
  • 3-Ethyl-2-methylpentane
  • NSC 73955
  • Pentane, 3-ethyl-2-methyl-
Found 3 products.