CAS 609-46-1
:2-Hydroxybenzenesulfonic acid
Description:
2-Hydroxybenzenesulfonic acid, also known as salicylsulfonic acid, is an aromatic sulfonic acid characterized by the presence of both a hydroxyl group (-OH) and a sulfonic acid group (-SO3H) attached to a benzene ring. This compound is typically a white to off-white crystalline solid that is soluble in water due to the polar nature of its functional groups. It exhibits acidic properties, making it useful in various chemical applications, including as a reagent in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. The presence of the hydroxyl group allows for potential hydrogen bonding, enhancing its solubility and reactivity. Additionally, 2-hydroxybenzenesulfonic acid can participate in electrophilic aromatic substitution reactions, making it a versatile compound in synthetic organic chemistry. Safety precautions should be taken when handling this substance, as it can be irritating to the skin and eyes.
Formula:C6H6O4S
InChI:InChI=1S/C6H6O4S/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4,7H,(H,8,9,10)
InChI key:InChIKey=IULJSGIJJZZUMF-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(O)C=CC=C1
Synonyms:- 2-Hydroxybenzene-1-sulfonic acid
- 2-Hydroxybenzenesulfonic acid
- 2-Sulfophenol
- Aseptol
- Benzenesulfonic acid, 2-hydroxy-
- Benzenesulfonic acid, o-hydroxy-
- NSC 227905
- NSC 243747
- Phenol-2-sulfonic acid
- o-Hydroxybenzenesulfonic acid
- o-Phenolsulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
