CAS 60903-82-4

4-Chloro-2,3,5,6-tetrafluorotoluene

Description:

4-Chloro-2,3,5,6-tetrafluorotoluene, with the CAS number 60903-82-4, is a halogenated aromatic compound characterized by the presence of both chlorine and fluorine substituents on a toluene ring. This compound features a methyl group attached to a benzene ring, which is further substituted with four fluorine atoms and one chlorine atom at specific positions. The presence of these electronegative halogens significantly influences its chemical properties, including increased polarity and potential reactivity. It is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. This compound is of interest in various applications, including as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fluorinated compounds. Its unique structure may also impart specific physical properties, such as higher boiling and melting points compared to non-halogenated toluene derivatives. Safety considerations are important when handling this substance due to its potential environmental impact and toxicity associated with halogenated compounds.

Formula: C₇H₃ClF₄

InChI: InChI=1/C7H3ClF4/c1-2-4(9)6(11)3(8)7(12)5(2)10/h1H3

SMILES: Cc1c(c(c(c(c1F)F)Cl)F)F

Synonyms:

• 1-Chloro-2,3,5,6-Tetrafluoro-4-Methylbenzene

4-Chloro-2,3,5,6-tetrafluorotoluene

CAS: 60903-82-4

4-Chloro-2,3,5,6-tetrafluorotoluene

Purity: ≥95%

Molecular weight: 198.55g/mol

Ref: 54-PC408159