CAS 60907-94-0: α-(2-Ethylphenyl)-2-furanmethanol

Description:α-(2-Ethylphenyl)-2-furanmethanol, with the CAS number 60907-94-0, is an organic compound characterized by its unique structure that combines a furan ring with an ethylphenyl group and a hydroxymethyl functional group. This compound typically exhibits a moderate polarity due to the presence of the hydroxymethyl group, which can participate in hydrogen bonding. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The furan ring contributes to its aromatic properties, potentially influencing its reactivity and interactions with other chemical species. This compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that can facilitate various chemical reactions. Additionally, its solubility characteristics may vary, making it suitable for different solvent systems. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula:C₁₃H₁₄O₂

InChI:InChI=1S/C13H14O2/c1-2-10-6-3-4-7-11(10)13(14)12-8-5-9-15-12/h3-9,13-14H,2H2,1H3

InChI key:InChIKey=CGTJFMGQTFPHQG-UHFFFAOYSA-N

SMILES:OC(C=1OC=CC1)C=2C=CC=CC2CC