CAS 6092-24-6
:2-Methoxyphenyl β-D-glucopyranoside
Description:
2-Methoxyphenyl β-D-glucopyranoside, with the CAS number 6092-24-6, is a glycoside compound characterized by the presence of a methoxyphenyl group attached to a β-D-glucopyranoside moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and methanol, reflecting the hydrophilic nature of the glucopyranoside unit. It is known for its potential biological activities, including antioxidant and anti-inflammatory properties, which make it of interest in pharmaceutical and nutraceutical research. The methoxy group enhances the lipophilicity of the molecule, potentially influencing its bioavailability and interaction with biological systems. Additionally, 2-Methoxyphenyl β-D-glucopyranoside may serve as a substrate for various enzymatic reactions, particularly in studies involving glycosidases. Its structural features and functional groups contribute to its reactivity and interactions in chemical and biological contexts, making it a valuable compound for further investigation in medicinal chemistry and related fields.
Formula:C13H18O7
InChI:InChI=1S/C13H18O7/c1-18-7-4-2-3-5-8(7)19-13-12(17)11(16)10(15)9(6-14)20-13/h2-5,9-17H,6H2,1H3/t9-,10-,11+,12-,13-/m1/s1
InChI key:InChIKey=WBZPEZUBVIAKKS-UJPOAAIJSA-N
SMILES:O([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C2=C(OC)C=CC=C2
Synonyms:- 2-Methoxyphenyl β-D-glucopyranoside
- β-D-Glucopyranoside, 2-methoxyphenyl
- Glucopyranoside, o-methoxyphenyl, β-D-
- Glucopyranoside, o-methoxyphenyl
- β-D-Glucoside, o-methoxyphenyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Guaiacol-β-D-glucopyranoside
CAS:Controlled ProductApplications Guaiacol-beta-D-glucopyranoside, is a Guaiacol Conjugate, that has shown to present in fermentation of grapes that had been exposed to bushfire smoke and can potentially yield unpalatable, smoke-affected wine.
References Hayasaka, Y.m et al.: J. Arg. Food Chem., Vol. 58, Issue 4, P: 2076; 2081 (2010);Formula:C13H18O7Color and Shape:NeatMolecular weight:286.28Guaiacol glucoside
CAS:Guaiacol glucoside is a phenolic glucoside, which is a type of chemical compound where a glycol, such as guaiacol, is bound to a glucose molecule. It is derived from the glucosylation of guaiacol, a natural phenol that is typically found in wood smoke and also present in certain essential oils. This compound functions as a glycoside that releases guaiacol upon enzymatic or acidic hydrolysis.Formula:C13H18O7Purity:Min. 95%Color and Shape:PowderMolecular weight:286.28 g/mol


