CAS 60920-82-3
:N-[(2S,3S,4R,5S)-4-allyloxy-2-benzyloxy-6-(benzyloxymethyl)-5-hydroxy-tetrahydropyran-3-yl]acetamide
Description:
N-[(2S,3S,4R,5S)-4-allyloxy-2-benzyloxy-6-(benzyloxymethyl)-5-hydroxy-tetrahydropyran-3-yl]acetamide, with the CAS number 60920-82-3, is a complex organic compound characterized by its intricate stereochemistry and functional groups. This molecule features a tetrahydropyran ring, which is a six-membered cyclic ether, and is substituted with various functional groups, including an acetamide moiety and multiple benzyloxy and allyloxy groups. The presence of these substituents suggests potential applications in medicinal chemistry, particularly in the development of glycosidase inhibitors or other bioactive compounds. The stereochemistry indicated by the (2S,3S,4R,5S) configuration implies specific spatial arrangements that can significantly influence the compound's biological activity and interactions with enzymes or receptors. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular structure, making it a subject of interest for further research in organic synthesis and pharmacology.
Formula:C25H31NO6
InChI:InChI=1/C25H31NO6/c1-3-14-30-24-22(26-18(2)27)25(31-16-20-12-8-5-9-13-20)32-21(23(24)28)17-29-15-19-10-6-4-7-11-19/h3-13,21-25,28H,1,14-17H2,2H3,(H,26,27)/t21?,22-,23+,24+,25-/m0/s1
Synonyms:- Benzyl 2-Acetamido-3-O-allyl-6-O-benzyl-2-deoxy-α-D-glucopyranoside
- 2-(AcetylaMino)-2-deoxy-6-O-(phenylMethyl)-3-O-2-propen-1-yl-α-D-glucopyranoside PhenylMethyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzyl 2-acetamido-3-O-allyl-6-O-benzyl-2-deoxy-a-D-glucopyranoside
CAS:<p>Benzyl 2-acetamido-3-O-allyl-6-O-benzyl-2-deoxy-aDglucopyranoside is an Oligosaccharide that contains a benzene ring. It has been synthesized by the method of glycosylation and click modification. This product is for research purposes only and should not be used as a food additive, preservative, or dietary supplement.</p>Formula:C25H31NO6Purity:Min. 95%Color and Shape:Off-White Beige PowderMolecular weight:441.52 g/molBenzyl 2-Acetamido-3-O-allyl-6-O-benzyl-2-deoxy-α-D-glucopyranoside
CAS:Controlled ProductFormula:C25H31NO6Color and Shape:NeatMolecular weight:441.52Benzyl 2-Acetamido-3-O-allyl-6-O-benzyl-2-deoxy-a-D-glucopyranoside
CAS:Formula:C25H31NO6Molecular weight:441.52



