CAS 60933-68-8
:2-3-5-tri-O-benzyl-B-D-arabino-furanose
Description:
2,3,5-Tri-O-benzyl-β-D-arabino-furanose is a synthetic carbohydrate derivative characterized by the presence of three benzyl groups attached to the hydroxyl positions at the 2, 3, and 5 positions of the β-D-arabino-furanose structure. This compound is a furanose form of the sugar, indicating a five-membered ring structure that includes an oxygen atom. The benzyl groups enhance the lipophilicity and stability of the molecule, making it useful in various organic synthesis applications, particularly in glycosylation reactions. The presence of these substituents can also influence the compound's reactivity and solubility in organic solvents. As a carbohydrate derivative, it may exhibit biological activity and can be utilized in the synthesis of more complex carbohydrates or glycosides. The compound's CAS number, 60933-68-8, allows for its identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and biochemistry.
Formula:C26H28O5
InChI:InChI=1/C26H28O5/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(31-26)19-28-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23-,24-,25-,26+/m1/s1
Synonyms:- 2,3,5-tri-O-benzylpentofuranose
- 2,3,5-Tri-O-benzoyl-beta-D-arabinofuranose
- 2,3,5-Tri-O-Benzyl-Beta-D-Arabinofuranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3,5-Tri-O-benzyl-β-D-arabinofuranose
CAS:An arabinofuranose derivative. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of theFormula:C26H28O5Molecular weight:420.52,3,5-Tri-O-benzyl-β-D-arabinofuranose
CAS:Formula:C26H28O5Purity:98%Color and Shape:SolidMolecular weight:420.4975(2R,3S,4R,5R)-3,4-Bis(benzyloxy)-5-((benzyloxy)methyl)tetrahydrofuran-2-ol
CAS:(2R,3S,4R,5R)-3,4-Bis(benzyloxy)-5-((benzyloxy)methyl)tetrahydrofuran-2-olPurity:98%Molecular weight:420.51g/mol2,3,5-Tri-O-benzyl-b-D-arabinofuranose
CAS:Formula:C26H28O5Purity:≥ 98.0%Color and Shape:White to light yellow crystalline powderMolecular weight:420.502,3,5-Tri-O-benzyl-β-D-arabinofuranose
CAS:2,3,5-Tri-O-benzyl-b-D-arabinofuranose is a stereoselective analog that inhibits human maltase glucoamylase and acetylation. It is also a potent nucleophile that reacts with the hydroxyl group of dimethyl fumarate to form an acetal linkage. This compound is used in the stereoselective synthesis of oligosaccharides and carbohydrates.Formula:C26H28O5Purity:Min. 99 Area-%Color and Shape:White PowderMolecular weight:420.5 g/mol(2R,3S,4R,5R)-3,4-Bis(benzyloxy)-5-((benzyloxy)methyl)tetrahydrofuran-2-ol
CAS:Purity:98%Molecular weight:420.5050049





