CAS 60964-09-2

2,6-Dichloro-4-hydroxybenzaldehyde

Description:

2,6-Dichloro-4-hydroxybenzaldehyde, with the CAS number 60964-09-2, is an organic compound characterized by its aromatic structure featuring both aldehyde and hydroxyl functional groups. It is a derivative of chlorinated phenols, specifically containing two chlorine atoms at the 2 and 6 positions of the benzene ring, and a hydroxyl group at the 4 position. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its chemical properties include moderate solubility in organic solvents and limited solubility in water, which is common for chlorinated aromatic compounds. The presence of the aldehyde group contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Additionally, the chlorinated nature of the compound may impart unique biological activities, making it of interest in medicinal chemistry and material science. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.

Formula: C₇H₄Cl₂O₂

InChI: InChI=1/C7H4Cl2O2/c8-6-1-4(11)2-7(9)5(6)3-10/h1-3,11H

SMILES: c1c(cc(c(C=O)c1Cl)Cl)O

Synonyms:

• Benzaldehyde, 2,6-Dichloro-4-Hydroxy-
• Vhr Dq Bg Fg
• 2,6-Dichloro-4-hydroxybenzaldehyde

2,6-Dichloro-4-Hydroxybenzaldehyde

CAS: 60964-09-2

Formula: C₇H₄Cl₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.0115

Ref: IN-DA003G2X

2,6-Dichloro-4-hydroxybenzaldehyde

CAS: 60964-09-2

2,6-Dichloro-4-hydroxybenzaldehyde

Purity: 98%

Molecular weight: 191.01g/mol

Ref: 54-OR59913

2,6-Dichloro-4-hydroxybenzaldehyde

CAS: 60964-09-2

2,6-Dichloro-4-hydroxybenzaldehyde is a chlorinated organic compound that can be synthesized by the chlorination of 2,6-dichlorobenzaldehyde. It has non-polar properties and can be used as an analytical reagent. Due to its chlorine atoms, it is used in the analysis of chlorine content in water and other substances. It is a formyl derivative and a homologue of formaldehyde. There are two isomers: 2,4-dichloro-6-hydroxybenzaldehyde (2,4 DCHA) and 2,5-dichloro-6-hydroxybenzaldehyde (2,5 DCHA).

Formula: C₇H₄Cl₂O₂

Purity: Min. 95%

Color and Shape: Yellow Powder

Molecular weight: 191.01 g/mol

Ref: 3D-FD69855

2,6-Dichloro-4-hydroxybenzaldehyde

CAS: 60964-09-2

Formula: C₇H₄Cl₂O₂

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 191.01

Ref: 10-F220261