CAS 6097-07-0
:2-pent-4-yn-1-yl-1H-isoindole-1,3(2H)-dione
Description:
2-Pent-4-yn-1-yl-1H-isoindole-1,3(2H)-dione, with the CAS number 6097-07-0, is a chemical compound that features a unique structure combining an isoindole moiety with a pentynyl side chain. This compound is characterized by its unsaturated alkyne functional group, which contributes to its reactivity and potential applications in organic synthesis. The isoindole structure is known for its aromatic properties and can participate in various chemical reactions, including electrophilic substitutions and cycloadditions. The presence of the dione functional group indicates that the compound has two carbonyl groups, which can engage in hydrogen bonding and influence its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can affect the compound's physical properties, such as melting point, boiling point, and spectral characteristics. Overall, 2-pent-4-yn-1-yl-1H-isoindole-1,3(2H)-dione represents a versatile structure in the realm of organic chemistry.
Formula:C13H11NO2
InChI:InChI=1/C13H11NO2/c1-2-3-6-9-14-12(15)10-7-4-5-8-11(10)13(14)16/h1,4-5,7-8H,3,6,9H2
SMILES:C#CCCCN1C(=O)c2ccccc2C1=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(4-Pentynyl)phthalimide, 97%
CAS:N-(4-Pentynyl)phthalimide is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referenFormula:C13H11NO2Purity:97%Color and Shape:White to yellow to pale brown, PowderMolecular weight:213.24N-(4-PENTYNYL)PHTHALIMIDE 97
CAS:Formula:C13H11NO2Purity:98%Color and Shape:SolidMolecular weight:213.23192-(Pent-4-yn-1-yl)isoindoline-1,3-dione
CAS:2-(Pent-4-yn-1-yl)isoindoline-1,3-dionePurity:97%Molecular weight:213.23g/mol2-(PENT-4-YNYL)ISOINDOLINE-1,3-DIONE
CAS:Formula:C13H11NO2Purity:98%Color and Shape:Liquid, No data available.Molecular weight:213.236




