CAS 60979-25-1
:3-amino-4-methoxybenzonitrile
Description:
3-Amino-4-methoxybenzonitrile is an organic compound characterized by the presence of an amino group (-NH2), a methoxy group (-OCH3), and a nitrile group (-CN) attached to a benzene ring. The amino group is located at the meta position relative to the methoxy group, while the nitrile group is at the para position. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals and organic synthesis, particularly as an intermediate in the production of various biologically active compounds. The presence of both electron-donating (methoxy) and electron-withdrawing (nitrile) groups influences its reactivity and properties, making it a valuable compound in medicinal chemistry. Additionally, the compound's characteristics, such as melting point, boiling point, and spectral properties, can be determined through various analytical techniques, including NMR and IR spectroscopy.
Formula:C8H8N2O
InChI:InChI=1/C8H8N2O/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4H,10H2,1H3
SMILES:COc1ccc(cc1N)C#N
Synonyms:- Benzonitrile, 3-Amino-4-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-4-methoxybenzonitrile
CAS:Formula:C8H8N2OPurity:97%Color and Shape:SolidMolecular weight:148.16193-Amino-4-methoxybenzonitrile
CAS:3-Amino-4-methoxybenzonitrileFormula:C8H8N2OPurity:97%Color and Shape: yellow brown solidMolecular weight:148.16g/mol3-Amino-4-methoxybenzonitrile
CAS:Formula:C8H8N2OPurity:97%Color and Shape:SolidMolecular weight:148.1653-Amino-4-methoxybenzonitrile
CAS:<p>3-Amino-4-methoxybenzonitrile is an inorganic acid that has been used as a reagent or intermediate in the synthesis of other compounds. It is soluble in water and reacts with acids to form salts. 3-Amino-4-methoxybenzonitrile can be used to synthesize amides and esters, as well as other compounds such as diamidines, dihydrobromide, monohydrochloride, hydrogen chloride, sulphonic acid, and organic acids. This compound also reacts with ammonia to produce hydrazine which is a highly toxic compound. Hydrates of this substance are sometimes found in nature.</p>Formula:C8H8N2OPurity:Min. 95%Molecular weight:148.17 g/mol



