CAS 609822-00-6

2,8-dimethylquinoline-4-carboxylic acid

Description:

2,8-Dimethylquinoline-4-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. This compound features two methyl groups at the 2 and 8 positions of the quinoline ring and a carboxylic acid functional group at the 4 position. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The methyl substituents can influence the compound's solubility, stability, and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the structural features can affect the compound's electronic properties, potentially leading to interesting photophysical behaviors. Overall, 2,8-dimethylquinoline-4-carboxylic acid is a versatile compound with applications in various fields, including organic synthesis and pharmaceuticals.

Formula: C₁₂H₁₁NO₂

InChI: InChI=1/C12H11NO2/c1-7-4-3-5-9-10(12(14)15)6-8(2)13-11(7)9/h3-6H,1-2H3,(H,14,15)

SMILES: Cc1cccc2c(cc(C)nc12)C(=O)O

Synonyms:

• 4-Quinolinecarboxylic Acid, 2,8-Dimethyl-

2,8-Dimethyl-4-quinolinecarboxylic acid

CAS: 609822-00-6

Formula: C₁₂H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.2212

Ref: IN-DA00EAUV

2,8-Dimethyl-4-quinolinecarboxylic acid

CAS: 609822-00-6

2,8-Dimethyl-4-quinolinecarboxylic acid

Purity: 95%

Molecular weight: 201.225g/mol

Ref: 54-OR74344

2,8-Dimethyl-quinoline-4-carboxylic acid

CAS: 609822-00-6

Formula: C₁₂H₁₁NO₂

Purity: 95%

Color and Shape: No data available.

Molecular weight: 201.225

Ref: 10-F059481