CAS 6099-03-2

o-Methoxycinnamic acid

Description:

o-Methoxycinnamic acid, also known as 2-methoxycinnamic acid, is an organic compound characterized by its aromatic structure and the presence of both a methoxy group and a carboxylic acid functional group. It typically appears as a white to pale yellow crystalline solid. The compound is known for its potential applications in the fields of pharmaceuticals and cosmetics, particularly due to its antioxidant and anti-inflammatory properties. Its molecular structure features a methoxy group (-OCH₃) attached to the aromatic ring, which influences its reactivity and solubility. o-Methoxycinnamic acid can undergo various chemical reactions, including esterification and amidation, making it a versatile intermediate in organic synthesis. Additionally, it has been studied for its potential role in UV protection and skin health, contributing to its relevance in cosmetic formulations. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks if ingested or improperly handled.

Formula: C₁₀H₉O₃

InChI: InChI=1S/C10H10O3/c1-13-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3,(H,11,12)

InChI key: InChIKey=FEGVSPGUHMGGBO-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=C(OC)C=CC=C1

3-(2-Methoxyphenyl)acrylic acid

CAS: 6099-03-2

Formula: C₁₀H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.1846

Ref: IN-DA00329Y

2-Methoxycinnamic acid

CAS: 6099-03-2

2-Methoxycinnamic acid

Purity: ≥98%

Molecular weight: 178.18g/mol

Ref: 54-BUP15767

2-Methoxycinnamic acid

CAS: 6099-03-2

Ref: 7W-GK3172

2-Methoxycinnamic acid

CAS: 6099-03-2

2-Methoxycinnamic acid

Formula: C₁₀H₁₀O₃

Purity: 98% +predominantly trans

Color and Shape: pale yellow solid

Molecular weight: 178.18g/mol

Ref: 54-OR21169

2-Methoxycinnamic acid

CAS: 6099-03-2

1. 2-Methoxycinnamic acid (o-Methoxycinnamic acid) can enhance inhibition of tyrosinase activity.

Formula: C₁₀H₁₀O₃

Purity: 99.68%

Color and Shape: Light Yellow Crystalline Powder

Molecular weight: 178.18

Ref: TM-T2S0973

2-Methoxycinnamic acid

CAS: 6099-03-2

2-Methoxycinnamic acid is a fine chemical that is used as a building block for research chemicals, pharmaceuticals, and other products. It is a versatile building block that can be used in the synthesis of complex compounds with diverse structures. 2-Methoxycinnamic acid is also an intermediate for the production of cinnamates, which are useful in the production of synthetic dyes.

Formula: C₁₀H₁₀O₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 178.18 g/mol

Ref: 3D-FM71289

3-(2-Methoxyphenyl)acrylic acid

CAS: 6099-03-2

Formula: C₁₀H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.187

Ref: 10-F324449