CAS 60992-98-5

4'-Fluorobiphenyl-4-carbaldehyde

Description:

4'-Fluorobiphenyl-4-carbaldehyde, with the CAS number 60992-98-5, is an organic compound characterized by its biphenyl structure substituted with a fluorine atom and an aldehyde functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a molecular formula that reflects its biphenyl backbone, with the aldehyde group contributing to its reactivity, particularly in nucleophilic addition reactions. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. 4'-Fluorobiphenyl-4-carbaldehyde is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in various chemical reactions. Additionally, its unique structural features may impart specific physical and chemical properties, such as boiling point and melting point, which are relevant for its handling and application in laboratory settings.

Formula: C₁₃H₉FO

InChI: InChI=1/C13H9FO/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11/h1-9H

SMILES: c1cc(ccc1C=O)c1ccc(cc1)F

Synonyms:

• 4'-Fluoro[1,1'-biphenyl]-4-carbaldehyde
• 4-(4-Fluorophenyl)benzaldehyde

4'-Fluorobiphenyl-4-carbaldehyde

CAS: 60992-98-5

Formula: C₁₃H₉FO

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.2084

Ref: IN-DA00E8WR

4'-Fluoro-[1,1'-biphenyl]-4-carboxaldehyde

CAS: 60992-98-5

4'-Fluoro-[1,1'-biphenyl]-4-carboxaldehyde

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 200.21g/mol

Ref: 54-PC11137

4-(4-Fluorophenyl)benzaldehyde

CAS: 60992-98-5

Formula: C₁₃H₉FO

Purity: 99%+(GC-MS);RG

Color and Shape: Solid

Molecular weight: 200.212

Ref: 10-F014278