CAS 61-47-2
:Serotonin creatinine sulfate monohydrate
Description:
Serotonin creatinine sulfate monohydrate is a chemical compound that combines serotonin, a neurotransmitter involved in regulating mood, with creatinine sulfate, a derivative of creatinine, which is a waste product formed from muscle metabolism. The compound is typically encountered in a crystalline form and is known for its role in various biochemical processes. Serotonin itself is derived from the amino acid tryptophan and is crucial for numerous physiological functions, including mood regulation, appetite, and sleep. The presence of the sulfate group can influence the solubility and stability of the compound in biological systems. As a monohydrate, it contains one molecule of water for each molecule of the compound, which can affect its physical properties, such as melting point and hygroscopicity. This compound is of interest in pharmacology and biochemistry, particularly in studies related to neurotransmission and metabolic pathways. However, handling and usage should be approached with caution due to the biological activity of serotonin and its potential effects on human health.
Formula:C10H13N2O
InChI:InChI=1/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/p+1
Synonyms:- 5-Hydroxytryptamine creatinine sulfate monohydrate
- 2-(2-Aminoethyl)Indole-5-Ol 2-Imino-1-Methylimidazoline-4-One Sulphate
- 2-amino-1-methyl-4-oxo-4,5-dihydro-1H-imidazol-1-ium 2-(5-hydroxy-1H-indol-3-yl)ethanaminium sulfate (1:1:1)
- 3-(2-aminoethyl)-1H-indol-5-ol
- 2-amino-1-methyl-5H-imidazol-4-one
- Sulfuric Acid
- Hydrate
- 2-(5-hydroxy-1H-indol-3-yl)ethanaminium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Serotonin creatinine sulfate monohydrate
CAS:Formula:C14H23N5O7SPurity:98%Color and Shape:SolidMolecular weight:405.4267Serotonin-α,α,β,β-d4 Creatinine SulfateComplex H2O
CAS:Purity:98 atom % DColor and Shape:White SolidMolecular weight:409.455-Hydroxytryptamine creatinine sulfate monohydrate
CAS:5-Hydroxytryptamine creatinine sulfate monohydrate (Serotonin creatinine sulfate monohydrate) is a neurotransmitter.Formula:C14H23N5O7SPurity:99.27%Color and Shape:Off-White SolidMolecular weight:405.435-Hydroxytryptamine creatinine sulfate (salt) monohydrate
CAS:Controlled ProductNeurotransmitterFormula:C14H23N5O7SMolecular weight:405.43 g/molSerotonin Creatinine Sulfate Monohydrate
CAS:Formula:C14H19N5O2·H2SO4·H2OPurity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:405.43Serotonin Creatine Sulfate Monohydrate (5-Hydroxy Tryptamine Creatinine Sulfate Monohydrate)
CAS:Controlled ProductApplications A tryptamine derivative; shows α-adrenolytic activities.
References Ishida, Yukio., et al.: Chem. Pharma. Bull., 25, 1851 (1977),Formula:C10H12N2O·C4H7N3O·H2O·H2O4SColor and Shape:NeatMolecular weight:405.435-Hydroxytryptamine creatine sulfate monohydrate
CAS:Controlled ProductPlease enquire for more information about 5-Hydroxytryptamine creatine sulfate monohydrate including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C10H12N2O·C4H7N3O·H2SO4·H2OColor and Shape:Off-White PowderMolecular weight:405.43 g/molRef: 3D-FH11777
Discontinued product






