CAS 61-74-5
:1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl]-1-(phenylmethyl)hydrazine
Description:
The chemical substance known as 1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl]-1-(phenylmethyl)hydrazine, with the CAS number 61-74-5, is a hydrazine derivative characterized by its complex structure that includes a benzodioxin moiety and a phenylmethyl group. This compound typically exhibits properties associated with hydrazines, such as being a potential reducing agent and having applications in organic synthesis. It may also display biological activity, making it of interest in medicinal chemistry. The presence of the benzodioxin ring contributes to its stability and reactivity, while the hydrazine functional group can participate in various chemical reactions, including condensation and oxidation. The compound is likely to be a solid at room temperature and may have moderate solubility in organic solvents. Safety considerations are important, as hydrazines can be toxic and potentially carcinogenic, necessitating careful handling and storage. Overall, this compound represents a unique structure with potential applications in both synthetic and pharmaceutical chemistry.
Formula:C16H18N2O2
InChI:InChI=1S/C16H18N2O2/c17-18(10-13-6-2-1-3-7-13)11-14-12-19-15-8-4-5-9-16(15)20-14/h1-9,14H,10-12,17H2
InChI key:InChIKey=IXTXYSAWZICAPV-UHFFFAOYSA-N
SMILES:C(N(CC1=CC=CC=C1)N)C2OC=3C(OC2)=CC=CC3
Synonyms:- 1-(1,4-Benzodioxan-2-ylmethyl)-1-benzylhydrazine
- Hydrazine, 1-[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]-1-(phenylmethyl)-
- 1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl]-1-(phenylmethyl)hydrazine
- 1,4-Benzodioxin, hydrazine deriv.
- Hydrazine, 1-(1,4-benzodioxan-2-ylmethyl)-1-benzyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
