CAS 610-09-3
:cis-1,2-Cyclohexanedicarboxylic acid
Description:
Cis-1,2-Cyclohexanedicarboxylic acid, with the CAS number 610-09-3, is a bicyclic organic compound characterized by the presence of two carboxylic acid functional groups (-COOH) attached to a cyclohexane ring. The "cis" configuration indicates that the carboxylic acid groups are positioned on the same side of the cyclohexane ring, which influences its physical and chemical properties. This compound is typically a white crystalline solid at room temperature and is soluble in polar solvents like water and alcohols due to the presence of the carboxylic acid groups. It exhibits moderate acidity, typical of dicarboxylic acids, and can participate in various chemical reactions, including esterification and amidation. Additionally, cis-1,2-Cyclohexanedicarboxylic acid can serve as a building block in organic synthesis and may be used in the production of polymers and other chemical intermediates. Its structural features contribute to its potential applications in pharmaceuticals and materials science.
Formula:C8H12O4
InChI:InChI=1/C8H12O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6+
InChI key:InChIKey=QSAWQNUELGIYBC-OLQVQODUNA-N
SMILES:C(O)(=O)[C@H]1[C@@H](C(O)=O)CCCC1
Synonyms:- (1R,2S)-cyclohexane-1,2-dicarboxylate
- 1,2-Cyclohexanedicarboxylic acid, (1R,2S)-rel-
- 1,2-Cyclohexanedicarboxylic acid, cis-
- NSC 57637
- cis-1,2-Cyclohexanedicarboxylic acid
- cis-1,2-Cyclohexanedioic acid
- cis-Hexahydrophthalic acid
- rel-(1R,2S)-1,2-Cyclohexanedicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1,2-Cyclohexanedicarboxylic acid, (1R,2S)-rel-
CAS:Formula:C8H12O4Purity:97%Color and Shape:SolidMolecular weight:172.1785Cis-1,2-cyclohexanedicarboxylic acid
CAS:<p>Cis-1,2-cyclohexanedicarboxylic acid</p>Formula:C8H12O4Purity:98%Color and Shape: white crystalline solidMolecular weight:172.18g/molcis-1,2-Cyclohexanedicarboxylic Acid
CAS:Formula:C8H12O4Purity:>98.0%(GC)(T)Color and Shape:White powder to crystalMolecular weight:172.18Mitiglinide Impurity 18 (cis-1,2-cyclohexanedicarboxylic acid)
CAS:Formula:C8H12O4Molecular weight:172.18cis-1,2-Cyclohexanedicarboxylic acid
CAS:<p>Cis-1,2-cyclohexanedicarboxylic acid is a fatty acid that belongs to the class of cyclohexane carboxylic acids. It has been shown to be an effective inhibitor of calcium stearate and borohydride reduction in vitro. The compound also inhibits the activity of enzymes that catalyze carboxylation reactions, such as fatty acid synthase (FAS) and acetyl-CoA carboxylase (ACC). Cis-1,2-cyclohexanedicarboxylic acid is a metabolite of hippuric acid, which is produced by the human liver. Hippuric acid may be used for cancer therapy because it is a good substrate for radiation and can inhibit tumor growth. This molecule has two enantiomers: cis and trans.</p>Formula:C8H12O4Purity:(%) Min. 98%Color and Shape:PowderMolecular weight:172.18 g/molcis-Cyclohexane-1,2-dicarboxylic acid
CAS:Formula:C8H12O4Purity:97.00%Color and Shape:Solid, White powderMolecular weight:172.18
