CAS 610-35-5: 4-Hydroxyphthalic acid
Description:4-Hydroxyphthalic acid, with the CAS number 610-35-5, is an organic compound that belongs to the class of phthalic acids. It features a phthalic acid backbone with a hydroxyl group (-OH) positioned at the 4th carbon of the aromatic ring, which contributes to its chemical properties. This compound is typically a white to off-white crystalline solid that is soluble in water and various organic solvents, depending on the pH. It exhibits both acidic and phenolic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. 4-Hydroxyphthalic acid is often used in the synthesis of polymers, dyes, and pharmaceuticals, and it can act as an intermediate in the production of other chemical compounds. Additionally, it has applications in the field of materials science, particularly in the development of resins and coatings. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation to skin and eyes.
Formula:C8H6O5
InChI:InChI=1S/C8H6O5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3,9H,(H,10,11)(H,12,13)
InChI key:InChIKey=MWRVRCAFWBBXTL-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(O)C=C1C(=O)O
- Synonyms:
- 1,2-Benzenedicarboxylic acid, 4-hydroxy-
- 3,4-Dicarboxyphenol
- 4-Hydroxy-2-Benzenedicarboxylicacid
- 4-Hydroxybenzene-1,2-Dicarboxylate
- 4-Hydroxybenzene-1,2-Dicarboxylic Acid
- 4-Hydroxyphthalic acid
- Akos 237-77
- Phthalic acid, 4-hydroxy-
- Rarechem Al Bo 0808
- 4-Hydroxy-1,2-benzenedicarboxylic acid
- See more synonyms
