CAS 610-36-6
:4-Amino-2-nitrobenzoic acid
Description:
4-Amino-2-nitrobenzoic acid, also known as 4-amino-2-nitrobenzoate or p-amino-2-nitrobenzoic acid, is an organic compound with the molecular formula C7H6N2O3. It features an amino group (-NH2) and a nitro group (-NO2) attached to a benzoic acid structure, making it a derivative of benzoic acid. This compound typically appears as a yellow crystalline solid and is soluble in water and organic solvents, depending on pH. Its melting point and solubility characteristics can vary based on purity and environmental conditions. 4-Amino-2-nitrobenzoic acid is primarily used in the synthesis of dyes, pharmaceuticals, and as an intermediate in organic synthesis. It exhibits properties such as being a weak acid due to the carboxylic acid group, and it can participate in various chemical reactions, including electrophilic substitution and coupling reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H6N2O4
InChI:InChI=1/C7H6N2O4/c8-4-1-2-5(7(10)11)6(3-4)9(12)13/h1-3H,8H2,(H,10,11)
SMILES:c1cc(c(cc1N)N(=O)=O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Amino-2-nitrobenzoic Acid
CAS:Formula:C7H6N2O4Purity:>98.0%(T)(HPLC)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:182.144-Amino-2-nitrobenzoic acid
CAS:Formula:C7H6N2O4Purity:98%Color and Shape:SolidMolecular weight:182.13354-Amino-2-nitrobenzoic acid
CAS:<p>4-Amino-2-nitrobenzoic acid is a chemical compound that can be found in human urine. It belongs to the group of amides and is an acidic substance. The pH optimum for 4-Amino-2-nitrobenzoic acid is between 1 and 2. This compound can be hydrolyzed by acidic conditions, forming an amide derivative. The uptake of 4-Amino-2-nitrobenzoic acid in humans and animals depends on the glomerular filtration rate, which influences how much of the compound will be excreted by the kidneys. The uptake also depends on the acetylation status of the compound, which is determined by its metabolism with phosphatase enzymes. Organic acids are also present in human urine, which may result in the formation of 4-Amino-2-nitrobenzoic acid as well as other compounds with similar structures.</p>Formula:C7H6N2O4Purity:Min. 95%Color and Shape:SolidMolecular weight:182.13 g/mol4-Amino-2-nitro-benzoic acid
CAS:Formula:C7H6N2O4Purity:97%Color and Shape:SolidMolecular weight:182.135




