CAS 610-74-2
:2,5-Diaminobenzoic acid
Description:
2,5-Diaminobenzoic acid, with the CAS number 610-74-2, is an aromatic amine and a derivative of benzoic acid. It features two amino groups (-NH2) located at the 2 and 5 positions of the benzene ring, which contributes to its basicity and reactivity. This compound is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, owing to the presence of the amino groups. It exhibits properties such as being a potential intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. The presence of multiple amine groups allows for various chemical reactions, including acylation and alkylation. Additionally, 2,5-diaminobenzoic acid can participate in hydrogen bonding, influencing its physical properties and interactions in biological systems. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, its unique structure and functional groups make it a valuable compound in organic synthesis and research applications.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,8-9H2,(H,10,11)
InChI key:InChIKey=UONVFNLDGRWLKF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C=CC(N)=C1
Synonyms:- 1,4-Diamino-2-benzoic acid
- 5-Aminoanthranilic acid
- Benzoic Acid, 2,5-Diamino-
- 2,5-Diaminobenzoic Acid
- 2,5-Diaminobenzoic acid
- 2,5-bis(azanyl)benzoic acid
- 2,5-diaminobenzoicaci
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,5-Diaminobenzoic acid
CAS:2,5-Diaminobenzoic acid is a metabolite of histidine and can be found in the urine. It can be used as a biomarker for the detection of renal disease, liver disease, and diabetes. 2,5-Diaminobenzoic acid is synthesized by the condensation of two molecules of histidine with one molecule of carbon dioxide from the air to form 2-amino-benzoic acid. The reaction requires molybdenum and hydrochloric acid to take place. The final product has fluorescence properties that can be visualized using UV light. The amount of 2,5-diaminobenzoic acid present in urine samples correlates with the level of biogenic amines such as tyramine, octopamine, dopamine, phenethylamine, tryptamine, beta-phenylethylamine (PEA), and 3-methoxytyramine.Formula:C7H8N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:152.15 g/mol2,5-Diaminobenzoic acid
CAS:Formula:C7H8N2O2Purity:97%Color and Shape:Solid, PowderMolecular weight:152.1532,5-Diaminobenzoic acid
CAS:2,5-Diaminobenzoic acid is a useful organic compound for research related to life sciences. The catalog number is T67030 and the CAS number is 610-74-2.Formula:C7H8N2O2Color and Shape:SolidMolecular weight:152.153




