CAS 610-90-2
:2,4,5-Trihydroxybenzoic acid
Description:
2,4,5-Trihydroxybenzoic acid, also known as gallic acid, is a naturally occurring organic compound with the molecular formula C7H6O5. It is characterized by the presence of three hydroxyl (-OH) groups and a carboxylic acid (-COOH) group attached to a benzene ring. This compound appears as a white to pale yellow crystalline powder and is soluble in water, alcohol, and ether. Gallic acid is known for its antioxidant properties and is commonly found in various plants, including oak galls, tea leaves, and certain fruits. It has applications in the food industry as a preservative and in the pharmaceutical sector for its potential health benefits, including anti-inflammatory and antimicrobial effects. Additionally, it serves as a precursor in the synthesis of various dyes and tannins. The compound's ability to form complexes with metal ions enhances its utility in analytical chemistry and environmental studies. Overall, 2,4,5-trihydroxybenzoic acid is a versatile compound with significant biological and industrial relevance.
Formula:C7H6O5
InChI:InChI=1S/C7H6O5/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2,8-10H,(H,11,12)
InChI key:InChIKey=GPDXFYPVHRESMA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C=C(O)C(O)=C1
Synonyms:- 3,4,6-Trihydroxybenzoic acid
- 2,4,5-Trihydroxybenzoic acid
- Benzoic acid, 2,4,5-trihydroxy-
- NSC 2813
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

