CAS 61012-39-3
:5-Phenyl-1H-1,2,4-triazole-3-ethanamine
Description:
5-Phenyl-1H-1,2,4-triazole-3-ethanamine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a phenyl group attached to the triazole ring, contributing to its aromatic properties and potential biological activity. The ethanamine moiety indicates the presence of an amine functional group, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. Typically, compounds like this may exhibit various pharmacological properties, making them of interest in medicinal chemistry and drug development. The presence of both the triazole and amine functionalities suggests potential applications in areas such as antifungal, antibacterial, or anticancer research. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific substituents on the triazole and phenyl groups, which can be tailored for desired biological activity or chemical properties. Overall, 5-Phenyl-1H-1,2,4-triazole-3-ethanamine represents a versatile scaffold for further chemical exploration and development.
Formula:C10H12N4
InChI:InChI=1S/C10H12N4/c11-7-6-9-12-10(14-13-9)8-4-2-1-3-5-8/h1-5H,6-7,11H2,(H,12,13,14)
InChI key:InChIKey=FJGWIYGKBUMGKA-UHFFFAOYSA-N
SMILES:C(CN)C=1NC(=NN1)C2=CC=CC=C2
Synonyms:- 2-(3-Phenyl-1H-1,2,4-triazol-5-yl)ethan-1-amine
- 2-(3-Phenyl-1H-1,2,4-triazol-5-yl)ethanamine
- 2-(5-Phenyl-1H-1,2,4-triazol-3-yl)ethan-1-amine
- 2-(5-Phenyl-4H-1,2,4-triazol-3-yl)ethan-1-amine
- 5-Phenyl-1H-1,2,4-triazole-3-ethanamine
- Iem 836
- 1H-1,2,4-Triazole-3-ethanamine, 5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
