CymitQuimica logo

CAS 61032-80-2

:

Papulacandin B

Description:
Papulacandin B is a naturally occurring compound classified as a cyclic lipopeptide, primarily known for its antifungal properties. It is derived from the fermentation of certain fungi, particularly those in the genus Papulaspora. The compound exhibits a complex structure characterized by a cyclic backbone and a fatty acid side chain, which contributes to its biological activity. Papulacandin B is particularly noted for its ability to inhibit the growth of various fungal pathogens, making it of interest in pharmaceutical research, especially in the development of antifungal agents. Its mechanism of action typically involves disrupting fungal cell wall synthesis, which is crucial for maintaining cell integrity. Additionally, Papulacandin B has been studied for its potential applications in agriculture and medicine, although further research is needed to fully understand its efficacy and safety profiles. As with many bioactive compounds, the specific characteristics, including solubility and stability, can vary based on environmental conditions and formulation.
Formula:C47H64O17
InChI:InChI=1/C47H64O17/c1-5-28(3)17-11-9-12-18-29(4)33(51)20-14-10-16-22-38(54)62-44-43(35(25-48)64-47(45(44)58)39-30(26-60-47)23-32(50)24-34(39)52)63-46-42(57)41(56)40(55)36(61-46)27-59-37(53)21-15-8-7-13-19-31(49)6-2/h7-10,12-16,18-19,21-24,28,31,33,35-36,40-46,48-52,55-58H,5-6,11,17,20,25-27H2,1-4H3/b8-7+,12-9+,14-10+,19-13+,21-15+,22-16+,29-18+/t28?,31?,33?,35-,36-,40+,41+,42-,43-,44+,45-,46+,47+/m1/s1
Synonyms:
  • Papulacandin B
  • Papulacandins B
  • β-D-Galactopyranoside, (1S,3'R,4'R,5'R,6'R)-3',4',5',6'-tetrahydro-3',5,7-trihydroxy-4'-[[(2E,4E,8E,10E)-7-hydroxy-8,14-dimethyl-1-oxo-2,4,8,10-hexadecatetraen-1-yl]oxy]-6'-(hydroxymethyl)spiro[isobenzofuran-1(3H),2'-[2H]pyran]-5'-yl, 6-[(2E,4Z,6E)-8-hydroxy-2,4,6-decatrienoate]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Papulacandins B

    CAS:
    <p>Papulacandin B is an antibiotic effective primarily against yeast, but it shows no activity against filamentous fungi, bacteria, or protozoa. Its mechanism of action involves inhibiting the synthesis of glucans in the yeast cell wall.</p>
    Formula:C47H64O17
    Color and Shape:Solid
    Molecular weight:901.00