CymitQuimica logo

CAS 61033-71-4

:

Benzenamine, 4-(4,5-dihydro-1H-imidazol-2-yl)-

Description:
Benzenamine, 4-(4,5-dihydro-1H-imidazol-2-yl)-, also known by its CAS number 61033-71-4, is an organic compound characterized by the presence of both an aniline group and a dihydroimidazole moiety. This compound features a benzene ring substituted with an amino group and a 4,5-dihydro-1H-imidazole ring, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in organic synthesis and medicinal chemistry. Its structure suggests potential biological activity, which may be explored in pharmaceutical applications. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C9H11N3
InChI:InChI=1S/C9H11N3/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4H,5-6,10H2,(H,11,12)
InChI key:HSJPRHDSBNINIJ-UHFFFAOYSA-N
SMILES:C1CN=C(N1)C2=CC=C(C=C2)N
Found 3 products.