CAS 61035-94-7

2-[2-(benzyloxy)phenyl]ethanamine hydrochloride

Description:

2-[2-(Benzyloxy)phenyl]ethanamine hydrochloride, with the CAS number 61035-94-7, is a chemical compound characterized by its structure, which includes an ethanamine backbone substituted with a benzyloxy group and a phenyl ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and organic solvents, reflecting its polar functional groups. The presence of the hydrochloride salt form enhances its solubility and stability, making it suitable for various applications in pharmaceutical research and development. The compound may exhibit biological activity due to its amine functionality, which can interact with biological receptors or enzymes. As with many amines, it may also participate in hydrogen bonding, influencing its reactivity and interactions in chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₅H₁₈ClNO

InChI: InChI=1/C15H17NO.ClH/c16-11-10-14-8-4-5-9-15(14)17-12-13-6-2-1-3-7-13;/h1-9H,10-12,16H2;1H

SMILES: c1ccc(cc1)COc1ccccc1CCN.Cl

2-[2-(Benzyloxy)phenyl]ethan-1-amine hydrochloride

CAS: 61035-94-7

Versatile small molecule scaffold

Formula: C₁₅H₁₈ClNO

Purity: Min. 95%

Molecular weight: 263.76 g/mol

Ref: 3D-LCA03594