CAS 61036-64-4
:Teicoplanin A 2
Description:
Teicoplanin A2 is a glycopeptide antibiotic derived from the fermentation of the bacterium *Amycolatopsis orientalis*. It is primarily used in clinical settings for the treatment of serious infections caused by Gram-positive bacteria, particularly those resistant to other antibiotics, such as methicillin-resistant *Staphylococcus aureus* (MRSA). The compound exhibits a mechanism of action that involves inhibiting bacterial cell wall synthesis by binding to the D-alanyl-D-alanine terminus of cell wall precursors, thereby disrupting the integrity of the bacterial cell wall. Teicoplanin A2 is characterized by its complex structure, which includes multiple sugar moieties and a lipid tail that contribute to its antibacterial activity and pharmacokinetic properties. It is typically administered via intramuscular or intravenous routes and has a relatively long half-life, allowing for less frequent dosing. The substance is generally well-tolerated, although potential side effects may include allergic reactions and nephrotoxicity in some patients. Its use is often guided by susceptibility testing to ensure effectiveness against specific pathogens.
Formula:Unspecified
InChI:InChI=1/C90H99Cl2N9O34/c1-5-6-7-8-9-10-11-12-60(110)95-69-76(116)73(113)58(32-103)132-89(69)135-80-55-27-41-28-56(80)128-51-20-16-39(23-46(51)92)79(134-88-68(94-35(3)105)75(115)72(112)57(31-102)131-88)70-86(124)99-66(87(125)126-4)44-29-42(106)30-54(130-90-78(118)77(117)74(114)59(33-104)133-90)61(44)43-21-37(14-17-47(43)107)63(82(120)101-70)96-84(122)65(41)97-83(121)64-40-24-49(109)34(2)52(26-40)129-53-25-36(13-18-48(53)108)62(93)81(119)100-67(85(123)98-64)71(111)38-15-19-50(127-55)45(91)22-38/h9-10,13-30,57-59,62-79,88-90,102-104,106-109,111-118H,5-8,11-12,31-33,93H2,1-4H3,(H,94,105)(H,95,110)(H,96,122)(H,97,121)(H,98,123)(H,99,124)(H,100,119)(H,101,120)/b10-9+
Synonyms:- Teichomycin A2
- Teichomycin A<sub>2</sub>
- Teicoplanin A 2
- Teicoplanin A 2 (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Teicoplanin A2 (Mixture of 2-1, 2-2, 2-3, 2-4 and 2-5)
CAS:Formula:C90H99Cl2N9O34Color and Shape:NeatMolecular weight:1921.7
