CAS 61037-79-4
:L-phenylalanyl-L-leucyl-L-alpha-glutamyl-L-alpha-glutamyl-L-valine
Description:
L-phenylalanyl-L-leucyl-L-alpha-glutamyl-L-alpha-glutamyl-L-valine, with the CAS number 61037-79-4, is a synthetic peptide composed of five amino acids: phenylalanine, leucine, glutamic acid, and valine. This compound exhibits characteristics typical of peptides, including a relatively low molecular weight and the ability to form hydrogen bonds, which can influence its solubility and stability in various environments. Peptides like this one often play roles in biological processes and can exhibit specific biological activities, such as acting as signaling molecules or influencing metabolic pathways. The presence of hydrophobic amino acids, such as phenylalanine and leucine, suggests that the peptide may have hydrophobic interactions, which can affect its conformation and interactions with other biomolecules. Additionally, the glutamic acid residues may contribute to the peptide's charge and reactivity, particularly in physiological conditions. Overall, this peptide's structure and composition suggest potential applications in biochemistry and pharmacology, although specific biological functions would require further investigation.
Formula:C30H45N5O10
InChI:InChI=1/C30H45N5O10/c1-16(2)14-22(34-26(40)19(31)15-18-8-6-5-7-9-18)29(43)33-20(10-12-23(36)37)27(41)32-21(11-13-24(38)39)28(42)35-25(17(3)4)30(44)45/h5-9,16-17,19-22,25H,10-15,31H2,1-4H3,(H,32,41)(H,33,43)(H,34,40)(H,35,42)(H,36,37)(H,38,39)(H,44,45)/t19-,20-,21-,22-,25-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](CCC(=O)O)C(=N[C@@H](CCC(=O)O)C(=N[C@@H](C(C)C)C(=O)O)O)O)O)N=C([C@H](Cc1ccccc1)N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
H-Phe-Leu-Glu-Glu-Val-OH
CAS:H-Phe-Leu-Glu-Glu-Val-OH is a synthetic amino acid molecule that is used as a substrate for protein synthesis. The solubilized and biochemically active H-Phe-Leu-Glu-Glu-Val-OH can be prepared by the reaction of glutamic acid with phenylalanine, leucine, and glycine. This product is an irreversible enzyme that has been conjugated to a linker to form a reversible linkage. A spectrometer can be used to analyze the chemical structure of this compound. It is soluble in water and has a molecular weight of 310. It contains two carboxyl groups and one amino group that are linked by amide bonds.
Formula:C30H45N5O10Purity:Min. 95%Molecular weight:635.71 g/mol
