CAS 61040-81-1
:3,5-Dimethoxy-4-methylbenzoic acid
Description:
3,5-Dimethoxy-4-methylbenzoic acid is an aromatic carboxylic acid characterized by its methoxy and methyl substituents on the benzene ring. The presence of two methoxy groups at the 3 and 5 positions and a methyl group at the 4 position contributes to its unique chemical properties, including its solubility and reactivity. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and acetone, but less soluble in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The compound may also show biological activity, making it of interest in pharmaceutical research. Its molecular structure influences its physical properties, such as melting point and boiling point, which are essential for applications in synthesis and formulation. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H12O4
InChI:InChI=1S/C10H12O4/c1-6-8(13-2)4-7(10(11)12)5-9(6)14-3/h4-5H,1-3H3,(H,11,12)
InChI key:InChIKey=QIBMVRYNEXOCCF-UHFFFAOYSA-N
SMILES:O(C)C1=C(C)C(OC)=CC(C(O)=O)=C1
Synonyms:- 3,5-Dimethoxy-p-toluic acid
- 3,5-Dimethoxy-p-toluic acid (COOH=1)
- Benzoic acid, 3,5-dimethoxy-4-methyl-
- p-Toluic acid, 3,5-dimethoxy-
- 3,5-Dimethoxy-4-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,5-Dimethoxy-4-methylbenzoic acid, 97%
CAS:3,5-Dimethoxy-4-methylbenzoic acid undergoes reduction in the presence of sodium in ethanol to prepare 1,4-dihydro-3,5-dimethoxy- kmethylbenzoic acid. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may
Formula:C10H11O4Purity:97%Color and Shape:Pale cream to pale brown, Crystals or powder or crystalline powderMolecular weight:195.203,5-Dimethoxy-4-methylbenzoic acid
CAS:Formula:C10H12O4Purity:98%Color and Shape:SolidMolecular weight:196.19993,5-Dimethoxy-4-methylbenzoic acid
CAS:3,5-Dimethoxy-4-methylbenzoic acidPurity:95%Molecular weight:196.20g/mol3,5-Dimethoxy-4-methylbenzoic acid
CAS:3,5-Dimethoxy-4-methylbenzoic acid is an organic compound that has a carboxylate group and a long chain. It is synthesized from 3,5-dimethoxybenzoic acid through the borohydride reduction of the primary alcohols to produce a mixture of 2,3,4-trimethoxybenzoic acid and 3,5-dimethoxybenzoic acid. The nitro group on the phenolic ring can be reduced to the corresponding amine with sodium borohydride. 3,5-Dimethoxy-4-methylbenzoic acid has been found in natural products such as Cephalotaxus fortunei and Acacia confusa.Formula:C10H12O4Purity:Min. 95%Color and Shape:PowderMolecular weight:196.2 g/mol3,5-Dimethoxy-4-methylbenzoic acid
CAS:Formula:C10H12O4Purity:95%Color and Shape:SolidMolecular weight:196.202




