CAS 61043-66-1

4-{[(1S)-1-methyl-2-({(2S)-2-[(4-nitrophenyl)amino]propanoyl}amino)-2-oxoethyl]amino}-4-oxobutanoic acid (non-preferred name)

Description:

The chemical substance known as 4-{[(1S)-1-methyl-2-({(2S)-2-[(4-nitrophenyl)amino]propanoyl}amino)-2-oxoethyl]amino}-4-oxobutanoic acid, with the CAS number 61043-66-1, is a complex organic compound characterized by its multi-functional structure. It features a butanoic acid backbone, which is substituted with various functional groups, including an oxo group and an amino group. The presence of a nitrophenyl moiety indicates potential for biological activity, possibly as a pharmaceutical agent. The stereochemistry is significant, with specific chiral centers contributing to its overall conformation and reactivity. This compound may exhibit properties such as solubility in polar solvents, and its interactions with biological systems could be influenced by its functional groups. Additionally, the presence of both amine and carboxylic acid functionalities suggests potential for forming salts or participating in peptide bond formation. Overall, this substance's intricate structure may lead to diverse applications in medicinal chemistry and biochemistry.

Formula: C₁₆H₂₀N₄O₇

InChI: InChI=1/C16H20N4O7/c1-9(17-11-3-5-12(6-4-11)20(26)27)15(24)19-16(25)10(2)18-13(21)7-8-14(22)23/h3-6,9-10,17H,7-8H2,1-2H3,(H,18,21)(H,22,23)(H,19,24,25)/t9-,10-/m0/s1

SMILES: C[C@@H](C(=NC(=O)[C@H](C)N=C(CCC(=O)O)O)O)Nc1ccc(cc1)N(=O)=O

Suc-Ala-Ala-pNA

CAS: 61043-66-1

Suc-Ala-Ala-pNA is a synthetic peptide that has been shown to inhibit the activity of enzymes in the metabolic pathway of cholesterol biosynthesis. It also inhibits the activity of phospholipase A2 and cyclooxygenase, which are involved in arachidonic acid metabolism. Suc-Ala-Ala-pNA is a hydrophobic molecule that can be used as an inhibitor for enzymes such as esterases, aminopeptidases, amidases, carboxypeptidases, and proteases. Suc-Ala-Ala-pNA has been shown to have antiatherosclerotic properties because it inhibits the production of lipid peroxides.

Formula: C₁₆H₂₀N₄O₇

Purity: Min. 95%

Molecular weight: 380.35 g/mol

Ref: 3D-SAA-3117