CAS 6107-03-5

3-[(methylsulfanyl)methyl]-4-(octyloxy)aniline methanesulfonate (1:1)

Description:

3-[(Methylsulfanyl)methyl]-4-(octyloxy)aniline methanesulfonate (1:1), with CAS number 6107-03-5, is a chemical compound characterized by its complex structure, which includes an aniline derivative with a methylsulfanyl group and an octyloxy substituent. This compound typically exhibits properties associated with both hydrophilicity and hydrophobicity due to the presence of the methanesulfonate group and the long octyloxy chain, respectively. As a result, it may have applications in various fields, including surfactants, emulsifiers, or as a reagent in organic synthesis. The methanesulfonate moiety enhances its solubility in polar solvents, while the octyloxy group contributes to its lipophilic characteristics. Additionally, the presence of the aniline structure suggests potential biological activity, making it of interest in pharmaceutical research. Overall, this compound's unique combination of functional groups allows for diverse interactions in chemical and biological systems, which can be exploited in various applications.

Formula: C₁₇H₃₁NO₄S₂

InChI: InChI=1/C16H27NOS.CH4O3S/c1-3-4-5-6-7-8-11-18-16-10-9-15(17)12-14(16)13-19-2;1-5(2,3)4/h9-10,12H,3-8,11,13,17H2,1-2H3;1H3,(H,2,3,4)

Synonyms:

• B 5885
• Benzenamine, 3-[(methylthio)methyl]-4-(octyloxy)-, methanesulfonate (1:1)

M&B 5885

CAS: 6107-03-5

M&B 5885 is a biaoctive chemical.

Formula: C₁₇H₃₁NO₄S₂

Color and Shape: Solid

Molecular weight: 377.56

Ref: TM-T33118