CymitQuimica logo

CAS 61078-14-6

:

1H-Benzimidazole, 1-methyl-2-(methylsulfonyl)-

Description:
1H-Benzimidazole, 1-methyl-2-(methylsulfonyl)-, with the CAS number 61078-14-6, is a chemical compound characterized by its benzimidazole core structure, which consists of a fused benzene and imidazole ring. This compound features a methyl group at the 1-position and a methylsulfonyl group at the 2-position of the benzimidazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonyl group, which can engage in hydrogen bonding. The compound may possess biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Its stability, reactivity, and potential applications in medicinal chemistry are influenced by the functional groups attached to the benzimidazole framework. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C9H10N2O2S
InChI:InChI=1S/C9H10N2O2S/c1-11-8-6-4-3-5-7(8)10-9(11)14(2,12)13/h3-6H,1-2H3
InChI key:VDZVTXFWEKBHBV-UHFFFAOYSA-N
SMILES:CN1C2=CC=CC=C2N=C1S(=O)(=O)C
Found 6 products.