CAS 61081-34-3

1-[(methylsulfonyl)methyl]-4-nitrobenzene

Description:

1-[(Methylsulfonyl)methyl]-4-nitrobenzene, with the CAS number 61081-34-3, is an organic compound characterized by its nitrobenzene structure substituted with a methylsulfonyl group. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the nitro group, which can influence its reactivity and polarity. The methylsulfonyl group enhances its solubility in polar solvents, making it useful in various chemical applications. The presence of both the nitro and sulfonyl functional groups suggests potential for electrophilic substitution reactions, as well as applications in organic synthesis and medicinal chemistry. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Safety data should be consulted, as compounds with nitro groups can sometimes be hazardous, and appropriate handling procedures should be followed. Overall, 1-[(methylsulfonyl)methyl]-4-nitrobenzene is a versatile compound with significant implications in both industrial and research settings.

Formula: C₈H₉NO₄S

InChI: InChI=1/C8H9NO4S/c1-14(12,13)6-7-2-4-8(5-3-7)9(10)11/h2-5H,6H2,1H3

SMILES: CS(=O)(=O)Cc1ccc(cc1)N(=O)=O

Benzene, 1-[(methylsulfonyl)methyl]-4-nitro-

CAS: 61081-34-3

Formula: C₈H₉NO₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 215.2264

Ref: IN-DA00IASY

1-[(Methylsulfonyl)methyl]-4-nitrobenzene

CAS: 61081-34-3

1-[(Methylsulfonyl)methyl]-4-nitrobenzene

Formula: C₈H₉NO₄S

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 215.23g/mol

Ref: 54-OR915066

1-(METHANESULFONYLMETHYL)-4-NITROBENZENE

CAS: 61081-34-3

Formula: C₈H₉NO₄S

Purity: 95.0%

Molecular weight: 215.22

Ref: 10-F505567