CAS 61090-95-7
:H-Tyr-D-Ala-Gly-Phe-Met-NH2
Description:
The chemical substance H-Tyr-D-Ala-Gly-Phe-Met-NH2, with the CAS number 61090-95-7, is a synthetic peptide that consists of a sequence of amino acids, including tyrosine (Tyr), D-alanine (D-Ala), glycine (Gly), phenylalanine (Phe), and methionine (Met), with an amide group at the C-terminus. This peptide is characterized by its specific sequence, which influences its biological activity and interactions. The presence of D-alanine suggests that it may exhibit resistance to enzymatic degradation, making it more stable in biological systems. The aromatic side chains from tyrosine and phenylalanine contribute to its hydrophobic properties, while the methionine residue can participate in various biochemical processes, including methylation reactions. Peptides like H-Tyr-D-Ala-Gly-Phe-Met-NH2 are often studied for their potential roles in pharmacology, particularly in the development of therapeutic agents that mimic natural peptides or hormones. Their properties, such as solubility, stability, and biological activity, are crucial for their application in drug design and development.
Formula:C28H38N6O6S
InChI:InChI=1/C28H38N6O6S/c1-17(32-27(39)21(29)14-19-8-10-20(35)11-9-19)26(38)31-16-24(36)33-23(15-18-6-4-3-5-7-18)28(40)34-22(25(30)37)12-13-41-2/h3-11,17,21-23,35H,12-16,29H2,1-2H3,(H2,30,37)(H,31,38)(H,32,39)(H,33,36)(H,34,40)/t17-,21+,22+,23+/m1/s1
Synonyms:- tyrosylalanylglycylphenylalanylmethioninamide
- L-tyrosyl-D-alanylglycyl-L-phenylalanyl-L-methioninamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
[D-Ala2]-Met-Enkephalinamide
CAS:[D-Ala2]-Met-Enkephalinamide: potent opioid, reduces bile flow centrally, analgesic.Formula:C28H38N6O6SMolecular weight:586.7[D-Ala2,Met5]-Enkephalinamide
CAS:[D-Ala2,Met5]-Enkephalinamide is a peptide that belongs to the group of opioid peptides. It acts as an agonist and binds to the µ-opioid receptor. This receptor is involved in transmitting signals from outside the cell to inside the cell by regulating ion channels and controlling protein interactions. The binding of [D-Ala2,Met5]-Enkephalinamide to this receptor results in an inhibitory effect on neurotransmitter release, leading to a decrease of pain sensation. It has also been shown that [D-Ala2,Met5]-Enkephalinamide can act as an antagonist at other opioid receptors, such as the κ-opioid receptor.Formula:C28H38N6O6SPurity:Min. 95%Molecular weight:586.7 g/mol



