CAS 61096-84-2

4-(hexyloxy)-3-methoxybenzaldehyde

Description:

4-(Hexyloxy)-3-methoxybenzaldehyde, with the CAS number 61096-84-2, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a methoxy group (-OCH3) and a hexyloxy group (-O-C6H13) attached to the benzene ring, contributing to its unique properties. The presence of these substituents influences its solubility, reactivity, and potential applications. Typically, compounds like this exhibit moderate to high lipophilicity due to the long hexyloxy chain, which can enhance their ability to interact with biological membranes. The methoxy group can also participate in various chemical reactions, such as electrophilic aromatic substitution. Additionally, the aldehyde functional group is reactive, making this compound useful in synthetic organic chemistry for the preparation of more complex molecules. Overall, 4-(hexyloxy)-3-methoxybenzaldehyde is of interest in fields such as materials science, pharmaceuticals, and organic synthesis due to its structural features and reactivity.

Formula: C₁₄H₂₀O₃

InChI: InChI=1/C14H20O3/c1-3-4-5-6-9-17-13-8-7-12(11-15)10-14(13)16-2/h7-8,10-11H,3-6,9H2,1-2H3

SMILES: CCCCCCOc1ccc(cc1OC)C=O

4-(Hexyloxy)-3-methoxybenzaldehyde

CAS: 61096-84-2

4-(Hexyloxy)-3-methoxybenzaldehyde

Formula: C₁₄H₂₀O₃

Purity: ≥95%

Color and Shape: clear yellow as liquid. yellow as solid fused solid

Molecular weight: 236.31g/mol

Ref: 54-OR2279

4-(Hexyloxy)-3-methoxybenzaldehyde

CAS: 61096-84-2

4-(Hexyloxy)-3-methoxybenzaldehyde is an aldehyde that has a molecular weight of 166.14 g/mol and the following connectivity:

Formula: C₁₄H₂₀O₃

Purity: Min. 95%

Molecular weight: 236.31 g/mol

Ref: 3D-LCA09684