CAS 611-01-8: 2,4-Dimethylbenzoic acid
Description:2,4-Dimethylbenzoic acid, with the CAS number 611-01-8, is an aromatic carboxylic acid characterized by a benzene ring substituted with two methyl groups at the 2 and 4 positions and a carboxylic acid group (-COOH) at the 1 position. This compound typically appears as a white to off-white crystalline solid and is known for its moderate solubility in water, while being more soluble in organic solvents such as ethanol and ether. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and acid-base reactions. 2,4-Dimethylbenzoic acid is utilized in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Its melting and boiling points, as well as its density, can vary, but it generally exhibits stability under standard conditions. Safety data indicates that it should be handled with care, as it may cause irritation to skin and eyes.
Formula:C9H9O2
InChI:InChI=1S/C9H10O2/c1-6-3-4-8(9(10)11)7(2)5-6/h3-5H,1-2H3,(H,10,11)
InChI key:InChIKey=BKYWPNROPGQIFZ-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(C=C1C)C
- Synonyms:
- 2,4-Dimethylbenzoate
- 4-Carboxy-1,3-dimethylbenzene
- Benzoic acid, 2,4-dimethyl-
- Nsc 407532
