CAS 611-03-0

2,4-diaminobenzoic acid

Description:

2,4-Diaminobenzoic acid, with the CAS number 611-03-0, is an organic compound that belongs to the class of aromatic amines. It features two amino groups (-NH2) attached to a benzoic acid structure, specifically at the 2 and 4 positions relative to the carboxylic acid group (-COOH). This compound is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, owing to its ability to form hydrogen bonds. It exhibits basic properties due to the presence of amino groups, which can accept protons. 2,4-Diaminobenzoic acid is primarily used in the synthesis of dyes, pharmaceuticals, and as a building block in organic chemistry. Additionally, it has applications in the production of certain polymers and as a reagent in various chemical reactions. Its biological significance includes potential roles in medicinal chemistry, particularly in the development of drugs targeting specific pathways. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures.

Formula: C₇H₈N₂O₂

InChI: InChI=1/C7H8N2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,8-9H2,(H,10,11)

SMILES: c1cc(c(cc1N)N)C(=O)O

Synonyms:

• Benzoic Acid, 2,4-Diamino-
• 2,4-Diaminobenzoic acid

Benzoic acid, 2,4-diamino-

CAS: 611-03-0

Formula: C₇H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.1506

Ref: IN-DA00F2YY

2,4-Diaminobenzoic acid

CAS: 611-03-0

2,4-Diaminobenzoic acid

Purity: 98%

Molecular weight: 152.15g/mol

Ref: 54-OR92900

2,4-Diaminobenzoic acid

CAS: 611-03-0

Formula: C₇H₈N₂O₂

Purity: 98%

Molecular weight: 152.153

Ref: 10-F452405

2,4-Diaminobenzoic Acid

Controlled Product

CAS: 611-03-0

Formula: C₇H₈N₂O₂

Color and Shape: Neat

Molecular weight: 152.151

Ref: TR-D415030