CAS 611-45-0
:1-benzylnaphthalene
Description:
1-Benzylnaphthalene is an organic compound characterized by its structure, which consists of a naphthalene ring system substituted with a benzyl group. This compound is typically a colorless to pale yellow liquid with a characteristic aromatic odor. It is relatively insoluble in water but soluble in organic solvents such as ethanol and ether. 1-Benzylnaphthalene exhibits a melting point that is generally above room temperature, indicating its solid state at lower temperatures, while its boiling point is significantly higher, reflecting its stability under heat. The compound is known for its applications in organic synthesis and as a potential intermediate in the production of various chemicals. Additionally, it has been studied for its photophysical properties and potential uses in materials science. As with many aromatic compounds, it may pose health risks if inhaled or ingested, necessitating proper handling and safety precautions in laboratory and industrial settings.
Formula:C17H14
InChI:InChI=1/C17H14/c1-2-7-14(8-3-1)13-16-11-6-10-15-9-4-5-12-17(15)16/h1-12H,13H2
SMILES:c1ccc(cc1)Cc1cccc2ccccc12
Synonyms:- (Phenylmethyl)Naphthalene
- Naphthalene, 1-(Phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
