CAS 611-79-0: 3,3′-Diaminobenzophenone
Description:3,3′-Diaminobenzophenone, with the CAS number 611-79-0, is an organic compound characterized by its structure, which features two amino groups (-NH2) attached to a benzophenone framework. This compound typically appears as a solid, often in a crystalline form, and is known for its potential applications in various fields, including dye manufacturing and as a photoinitiator in polymer chemistry. It exhibits good solubility in organic solvents, which makes it useful in formulations requiring compatibility with other organic materials. The presence of amino groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as coupling reactions in dye synthesis. Additionally, 3,3′-Diaminobenzophenone can absorb ultraviolet light, making it valuable in applications related to UV protection. However, it is essential to handle this compound with care, as it may pose health risks, including potential skin and respiratory irritation. Proper safety measures should be observed when working with this substance in laboratory or industrial settings.
Formula:C13H12N2O
InChI:InChI=1S/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2
InChI key:InChIKey=TUQQUUXMCKXGDI-UHFFFAOYSA-N
SMILES:O=C(C=1C=CC=C(N)C1)C=2C=CC=C(N)C2
- Synonyms:
- 3,3′-Diaminodiphenylketone
- Benzophenone, 3,3′-diamino-
- Bis(3-Aminophenyl)Methanone
- Methanone, bis(3-aminophenyl)-
- NSC 113058
- m,m′-Diaminobenzophenone
- 3,3′-Diaminobenzophenone
