CAS 611168-63-9

tributyl-(5-chloro-2-pyridyl)stannane

Description:

Tributyl-(5-chloro-2-pyridyl)stannane, with the CAS number 611168-63-9, is an organotin compound characterized by the presence of a tributyl group and a 5-chloro-2-pyridyl moiety. This compound typically exhibits a high degree of lipophilicity due to the bulky tributyl groups, which can influence its solubility and reactivity in various environments. Organotin compounds are known for their applications in agriculture, particularly as biocides and fungicides, owing to their ability to disrupt biological processes in target organisms. The presence of the chloro-substituent on the pyridine ring may enhance its biological activity and stability. Additionally, the compound's tin atom can participate in coordination chemistry, potentially forming complexes with various ligands. However, organotin compounds are also subject to environmental scrutiny due to their toxicity and potential for bioaccumulation. Safety measures should be taken when handling such substances, as they can pose health risks to humans and ecosystems.

Formula: C₁₇H₃₀ClNSn

InChI: InChI=1/C5H3ClN.3C4H9.Sn/c6-5-2-1-3-7-4-5;3*1-3-4-2;/h1-2,4H;3*1,3-4H2,2H3;/rC17H30ClNSn/c1-4-7-12-20(13-8-5-2,14-9-6-3)17-11-10-16(18)15-19-17/h10-11,15H,4-9,12-14H2,1-3H3

SMILES: CCCC[Sn](CCCC)(CCCC)c1ccc(cn1)Cl

5-Chloro-2-(tributylstannyl)pyridine

CAS: 611168-63-9

5-Chloro-2-(tributylstannyl)pyridine

Formula: C₁₇H₃₀ClNSn

Purity: 96%

Color and Shape: colourless liquid

Molecular weight: 402.59g/mol

Ref: 54-OR960631

2-(Tributylstannyl)-5-chloropyridine

Controlled Product

CAS: 611168-63-9

Versatile small molecule scaffold

Formula: C₁₇H₃₀ClNSn

Purity: Min. 95%

Molecular weight: 402.59 g/mol

Ref: 3D-LZA16863