CAS 61123-71-5

Disilane, hexa(methyl-d3)-

Description:

Disilane, hexa(methyl-d3)-, with the CAS number 61123-71-5, is a silane compound characterized by its structure, which consists of two silicon atoms bonded to six deuterated methyl groups (methyl-d3). This compound is a derivative of disilane, where the hydrogen atoms in the methyl groups are replaced by deuterium, an isotope of hydrogen. As a result, it exhibits unique properties, including altered physical and chemical behavior compared to its non-deuterated counterparts. Disilane compounds are generally known for their use in the semiconductor industry, particularly in the deposition of silicon films. The presence of deuterium can also make this compound useful in various analytical applications, such as nuclear magnetic resonance (NMR) spectroscopy, where it can serve as a reference standard. Additionally, the stability and reactivity of disilanes can vary based on their substituents, influencing their applications in materials science and organic synthesis. Overall, disilane, hexa(methyl-d3)- is a specialized compound with significant relevance in both industrial and research settings.

Formula: C₆D₁₈Si₂

InChI: InChI=1S/C6H18Si2/c1-7(2,3)8(4,5)6/h1-6H3/i1D3,2D3,3D3,4D3,5D3,6D3

InChI key: InChIKey=NEXSMEBSBIABKL-NBDUPMGQSA-N

SMILES: [Si]([Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H]

Synonyms:

• Disilane, hexa(methyl-d3)-

Hexamethyl-d18-disilane

CAS: 61123-71-5

Formula: (CD₃)₃SiSi(CD₃)₃

Purity: 99 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 164.20769

Ref: 3U-D5476

Hexamethyl-d18-disilane

Controlled Product

CAS: 61123-71-5

Applications Hexamethyl-d18-disilane (CAS# 61123-71-5) is a useful isotopically labeled research compound.

Formula: C₆D₁₈Si₂

Color and Shape: Neat

Molecular weight: 164.49

Ref: TR-H281218