CymitQuimica logo

CAS 6113-85-5

:

N-[5-amino-2-(octyloxy)benzyl]benzamide

Description:
N-[5-amino-2-(octyloxy)benzyl]benzamide, with the CAS number 6113-85-5, is an organic compound characterized by its amide functional group and a benzene ring structure. This compound features an amino group (-NH2) and an octyloxy side chain, which contributes to its hydrophobic properties. The presence of the octyloxy group enhances its solubility in organic solvents while potentially limiting its solubility in water. The compound is likely to exhibit moderate to high melting and boiling points due to the presence of strong intermolecular forces, such as hydrogen bonding, associated with the amide and amino groups. Its structure suggests potential applications in pharmaceuticals or as a chemical intermediate, particularly in the synthesis of more complex organic molecules. Additionally, the presence of the amino group may impart biological activity, making it of interest in medicinal chemistry. However, specific reactivity and stability characteristics would depend on the conditions under which the compound is used or synthesized.
Formula:C22H30N2O2
InChI:InChI=1/C22H30N2O2/c1-2-3-4-5-6-10-15-26-21-14-13-20(23)16-19(21)17-24-22(25)18-11-8-7-9-12-18/h7-9,11-14,16H,2-6,10,15,17,23H2,1H3,(H,24,25)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.