CAS 61145-33-3
:Cyanomethyl 2,3,4,6-Tetra-O-Acetyl-1-Thio-b-D -Galactopyranoside
Description:
Cyanomethyl 2,3,4,6-Tetra-O-Acetyl-1-Thio-β-D-Galactopyranoside is a chemical compound that belongs to the class of thio-glycosides, specifically a thio-galactoside derivative. It features a galactopyranoside structure with multiple acetyl groups, which enhance its solubility and stability. The presence of the cyanomethyl group indicates that it can participate in nucleophilic reactions, making it useful in synthetic organic chemistry. The acetyl groups serve to protect the hydroxyl functionalities during chemical reactions, allowing for selective modifications. This compound is typically used in carbohydrate chemistry for the synthesis of more complex molecules, including glycosides and oligosaccharides. Its thioether linkage contributes to its reactivity and potential applications in glycosylation reactions. The compound is generally handled with standard laboratory safety precautions, as with many organic chemicals, due to potential hazards associated with its reactivity and the presence of the cyanomethyl group.
Formula:C16H21NO9S
InChI:InChI=1/C16H21NO9S/c1-8(18)22-7-12-13(23-9(2)19)14(24-10(3)20)15(25-11(4)21)16(26-12)27-6-5-17/h12-16H,6-7H2,1-4H3
SMILES:CC(=O)OCC1C(C(C(C(O1)SCC#N)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:- [(2,3,4,6-tetra-O-acetylhexopyranosyl)thio]acetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cyanomethyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-galactopyranoside
CAS:Formula:C16H21NO9SPurity:95%Color and Shape:SolidMolecular weight:403.4042Cyanomethyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-galactopyranoside
CAS:Cyanomethyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-galactopyranosideFormula:C16H21NO9SPurity:≥95%Color and Shape: white crystalline powderMolecular weight:403.40g/molCyanomethyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-galactopyranoside
CAS:Formula:C16H21NO9SMolecular weight:403.40Cyanomethyl 2,3,4,6-Tetra-O-acetyl-1-thio-Beta-D-galactopyranoside
CAS:Controlled ProductApplications The nitrile of the cyanomethyl group can be converted to a methyl imidate group by treatment with sodium methoxide or HCl which can be used to attach the sugar to a protein.
References Lee, Y-C, et al.: Biochemistry, 15, 18, 3956 (1976), Lee, Y-C, et al.: Biochemistry, 19, 4899 (1980)Formula:C16H21NO9SColor and Shape:NeatMolecular weight:403.4Cyanomethyl 2,3,4,6-tetra-O-acetyl-b-D-thioglucopyranoside
CAS:Cyanomethyl 2,3,4,6-tetra-O-acetyl-b-D-thioglucopyranoside is a synthetic glycosylation agent. It is an acetal derivative of b-D-thioglucopyranoside with a terminal methyl group at C2 and a fluorine atom at C6. This product can be used to modify saccharides and sugars in a variety of ways. It has been shown to react with various carbohydrates including polysaccharides and oligosaccharides. Synthetic glycosylations are often used in the synthesis of complex carbohydrates for use in pharmaceuticals or chemical engineering. The CAS number for this product is 61145-33-3.Formula:C16H21NO9SPurity:Min. 95%Molecular weight:403.41 g/molCyanomethyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside
CAS:Cyanomethyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside is an important reagent for the synthesis of glycosides and oligosaccharides. This substance has been used to synthesize a variety of modified saccharides, such as methylated sugars and fluorinated saccharides. It also has been applied to the synthesis of complex carbohydrates with the click modification.Formula:C16H21NO9SPurity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:403.41 g/molRef: 3D-MC04530
Discontinued product




