CAS 61147-65-7
:(2E)-3-(2-cyanophenyl)prop-2-enoic acid
Description:
(2E)-3-(2-cyanophenyl)prop-2-enoic acid, also known as a derivative of cinnamic acid, is characterized by its unique structural features, including a prop-2-enoic acid backbone with a cyanophenyl substituent. This compound typically exhibits a conjugated double bond system, which contributes to its potential reactivity and stability. The presence of the cyano group (-C≡N) enhances its polarity and may influence its solubility in various solvents. As an organic acid, it can participate in acid-base reactions, and its carboxylic acid functional group (-COOH) is responsible for its acidic properties. The compound may also display interesting optical properties due to its conjugated system, making it of interest in various applications, including organic synthesis and materials science. Additionally, its structural characteristics may allow for interactions with biological systems, suggesting potential applications in pharmaceuticals or agrochemicals. Overall, (2E)-3-(2-cyanophenyl)prop-2-enoic acid is a versatile compound with a range of chemical properties that can be explored in various scientific fields.
Formula:C10H7NO2
InChI:InChI=1/C10H7NO2/c11-7-9-4-2-1-3-8(9)5-6-10(12)13/h1-6H,(H,12,13)/b6-5+
Synonyms:- (2E)-3-(2-Cyanophenyl)acrylic acid
- 2-Cyanocinnamic acid
- 2-Propenoic acid, 3-(2-cyanophenyl)-, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Cyanocinnamic acid
CAS:<p>2-Cyanocinnamic acid is a fatty acid that has been shown to inhibit the synthesis of proteins. It binds to cytochrome c oxidase, inhibiting mitochondrial respiration and electron transport, leading to decreased ATP production. 2-Cyanocinnamic acid is not easily transported out of mitochondria, which leads to its accumulation in the mitochondrial matrix. This accumulation causes synergistic inhibition with glutamate, leading to a decrease in ATP production and an increase in intracellular levels of reactive oxygen species (ROS). The use of 2-cyanoacrylic acid as a mitochondrial transport inhibitor has been proposed for the treatment of obesity and diabetes.<br>2-Cyanocinnamic acid also inhibits fatty acid uptake by binding to the protein translocase at the outer membrane of cells. This binding prevents monomers from entering the cell, where they are broken down by beta oxidation and converted into acetyl-CoA, which can be used for energy production or stored as triglycer</p>Formula:C10H7NO2Purity:Min. 95%Molecular weight:173.17 g/mol
