CAS 61148-29-6

tetrazolo[1,5-a]quinoxalin-4-amine

Description:

Tetrazolo[1,5-a]quinoxalin-4-amine is a heterocyclic compound characterized by the presence of a tetrazole ring fused to a quinoxaline structure. This compound features a nitrogen-rich tetrazole moiety, which contributes to its potential biological activity and reactivity. The amine functional group at the 4-position of the quinoxaline ring enhances its solubility and reactivity, making it a candidate for various chemical reactions and applications in medicinal chemistry. Tetrazolo[1,5-a]quinoxalin-4-amine is often studied for its potential as a pharmacophore in drug development, particularly in the context of anti-cancer and anti-inflammatory agents. Its unique structure allows for diverse interactions with biological targets, and it may exhibit interesting electronic properties due to the presence of multiple nitrogen atoms. Additionally, the compound's stability and reactivity can be influenced by substituents on the quinoxaline or tetrazole rings, making it a versatile scaffold for further chemical modifications.

Formula: C₈H₆N₆

InChI: InChI=1/C8H6N6/c9-7-8-11-12-13-14(8)6-4-2-1-3-5(6)10-7/h1-4H,(H2,9,10)

SMILES: c1ccc2c(c1)nc(c1nnnn21)N

Synonyms:

• 1,2,3,5,9b-Pentaaza-cyclopenta[a]naphthalen-4-ylamine

[1,2,3,4]Tetrazolo[1,5-a]quinoxalin-4-amine

CAS: 61148-29-6

Versatile small molecule scaffold

Formula: C₈H₆N₆

Purity: Min. 95%

Molecular weight: 186.17 g/mol

Ref: 3D-LCA14829